C14H9NO2S — CID 134879076
11H-benzo[c][1,5]benzothiazocine-6,12-dione (PubChem CID 134879076) has the molecular formula C14H9NO2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 11H-benzo[c][1,5]benzothiazocine-6,12-dione.
| Compound Name | 11H-benzo[c][1,5]benzothiazocine-6,12-dione |
|---|---|
| PubChem CID | 134879076 |
| Molecular Formula | C14H9NO2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 11H-benzo[c][1,5]benzothiazocine-6,12-dione |
| SMILES | O=C1Sc2ccccc2C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H9NO2S/c16-13-10-6-2-4-8-12(10)18-14(17)9-5-1-3-7-11(9)15-13/h1-8H,(H,15,16) |
| InChIKey | NAXUFIBABWUEPL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|