About copper;1H-indole-2,3-dione
copper;1H-indole-2,3-dione (PubChem CID 70626411) has the molecular formula C8H5CuNO2
and a molecular weight of 210.68 g/mol. Its IUPAC name is copper;1H-indole-2,3-dione.
Molecular Properties
| Compound Name | copper;1H-indole-2,3-dione |
| PubChem CID | 70626411 |
| Molecular Formula | C8H5CuNO2 |
| Molecular Weight | 210.68 g/mol |
| Exact Mass | 209.96 |
| IUPAC Name | copper;1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccccc2C1=O.[Cu] |
| InChI | InChI=1S/C8H5NO2.Cu/c10-7-5-3-1-2-4-6(5)9-8(7)11;/h1-4H,(H,9,10,11); |
| InChIKey | KVDGCZDMVLEFCQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.68 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze copper;1H-indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1H-indole-2,3-dione?
The IUPAC name of copper;1H-indole-2,3-dione (CID 70626411) is copper;1H-indole-2,3-dione.
What is the SMILES notation for copper;1H-indole-2,3-dione?
The canonical SMILES for copper;1H-indole-2,3-dione is O=C1Nc2ccccc2C1=O.[Cu].
What is the InChIKey of copper;1H-indole-2,3-dione?
The InChIKey is KVDGCZDMVLEFCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.Cu/c10-7-5-3-1-2-4-6(5)9-8(7)11;/h1-4H,(H,9,10,11);.
What are the key properties of copper;1H-indole-2,3-dione?
copper;1H-indole-2,3-dione has a molecular weight of 210.68 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1H-indole-2,3-dione is sourced from PubChem (CID 70626411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).