C8H5CuNO2 — CID 70626411
copper;1H-indole-2,3-dione (PubChem CID 70626411) has the molecular formula C8H5CuNO2 and a molecular weight of 210.68 g/mol. Its IUPAC name is copper;1H-indole-2,3-dione.
| Compound Name | copper;1H-indole-2,3-dione |
|---|---|
| PubChem CID | 70626411 |
| Molecular Formula | C8H5CuNO2 |
| Molecular Weight | 210.68 g/mol |
| Exact Mass | 209.96 |
| IUPAC Name | copper;1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccccc2C1=O.[Cu] |
| InChI | InChI=1S/C8H5NO2.Cu/c10-7-5-3-1-2-4-6(5)9-8(7)11;/h1-4H,(H,9,10,11); |
| InChIKey | KVDGCZDMVLEFCQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.68 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|