C26H19NO2 — CID 175350104
1,4-diphenylbenzene;1H-indole-2,3-dione (PubChem CID 175350104) has the molecular formula C26H19NO2 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1,4-diphenylbenzene;1H-indole-2,3-dione.
| Compound Name | 1,4-diphenylbenzene;1H-indole-2,3-dione |
|---|---|
| PubChem CID | 175350104 |
| Molecular Formula | C26H19NO2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1,4-diphenylbenzene;1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccccc2C1=O.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H14.C8H5NO2/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;10-7-5-3-1-2-4-6(5)9-8(7)11/h1-14H;1-4H,(H,9,10,11) |
| InChIKey | QTQAVHHHVKWLLQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|