C13H8FNOS — CID 150355341
9-fluoro-5H-benzo[b][1,4]benzothiazepin-6-one (PubChem CID 150355341) has the molecular formula C13H8FNOS and a molecular weight of 245.28 g/mol. Its IUPAC name is 9-fluoro-5H-benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 9-fluoro-5H-benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 150355341 |
| Molecular Formula | C13H8FNOS |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 9-fluoro-5H-benzo[b][1,4]benzothiazepin-6-one |
| SMILES | O=C1Nc2ccccc2Sc2cc(F)ccc21 |
| InChI | InChI=1S/C13H8FNOS/c14-8-5-6-9-12(7-8)17-11-4-2-1-3-10(11)15-13(9)16/h1-7H,(H,15,16) |
| InChIKey | GUPGUKZYTOCKNR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |