C19H13FN2OS2 — CID 139309488
3-(4-fluoroanilino)sulfanyl-5H-benzo[b][1,4]benzothiazepin-6-one (PubChem CID 139309488) has the molecular formula C19H13FN2OS2 and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-(4-fluoroanilino)sulfanyl-5H-benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 3-(4-fluoroanilino)sulfanyl-5H-benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 139309488 |
| Molecular Formula | C19H13FN2OS2 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3-(4-fluoroanilino)sulfanyl-5H-benzo[b][1,4]benzothiazepin-6-one |
| SMILES | O=C1Nc2cc(SNc3ccc(F)cc3)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C19H13FN2OS2/c20-12-5-7-13(8-6-12)22-25-14-9-10-18-16(11-14)21-19(23)15-3-1-2-4-17(15)24-18/h1-11,22H,(H,21,23) |
| InChIKey | IAIACOFEFIQXMA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|