C20H15FN2OS2 — CID 139309727
3-[(4-fluorophenyl)methylamino]sulfanyl-5H-benzo[b][1,4]benzothiazepin-6-one (PubChem CID 139309727) has the molecular formula C20H15FN2OS2 and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylamino]sulfanyl-5H-benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 3-[(4-fluorophenyl)methylamino]sulfanyl-5H-benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 139309727 |
| Molecular Formula | C20H15FN2OS2 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3-[(4-fluorophenyl)methylamino]sulfanyl-5H-benzo[b][1,4]benzothiazepin-6-one |
| SMILES | O=C1Nc2cc(SNCc3ccc(F)cc3)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C20H15FN2OS2/c21-14-7-5-13(6-8-14)12-22-26-15-9-10-19-17(11-15)23-20(24)16-3-1-2-4-18(16)25-19/h1-11,22H,12H2,(H,23,24) |
| InChIKey | YGQJXAZSLZHPSW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|