C15H15ClN2O — CID 142815954
3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one;ethane (PubChem CID 142815954) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one;ethane.
| Compound Name | 3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one;ethane |
|---|---|
| PubChem CID | 142815954 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one;ethane |
| SMILES | CC.O=C1Nc2cc(Cl)ccc2Nc2ccccc21 |
| InChI | InChI=1S/C13H9ClN2O.C2H6/c14-8-5-6-11-12(7-8)16-13(17)9-3-1-2-4-10(9)15-11;1-2/h1-7,15H,(H,16,17);1-2H3 |
| InChIKey | BINBIDAUOVHGTC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |