C17H19ClN4 — CID 136597458
2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]-N-ethylethanamine (PubChem CID 136597458) has the molecular formula C17H19ClN4 and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]-N-ethylethanamine.
| Compound Name | 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]-N-ethylethanamine |
|---|---|
| PubChem CID | 136597458 |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]-N-ethylethanamine |
| SMILES | CCNCC/N=C1\Nc2cc(Cl)ccc2Nc2ccccc21 |
| InChI | InChI=1S/C17H19ClN4/c1-2-19-9-10-20-17-13-5-3-4-6-14(13)21-15-8-7-12(18)11-16(15)22-17/h3-8,11,19,21H,2,9-10H2,1H3,(H,20,22) |
| InChIKey | JWSXGHUHWQBNLC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|