C24H23Cl2N4+ — CID 11038068
3-chloro-6-[4-[(2-chlorophenyl)methyl]piperazin-1-ium-1-ylidene]-5,11-dihydrobenzo[b][1,4]benzodiazepine (PubChem CID 11038068) has the molecular formula C24H23Cl2N4+ and a molecular weight of 438.38 g/mol. Its IUPAC name is 3-chloro-6-[4-[(2-chlorophenyl)methyl]piperazin-1-ium-1-ylidene]-5,11-dihydrobenzo[b][1,4]benzodiazepine.
| Compound Name | 3-chloro-6-[4-[(2-chlorophenyl)methyl]piperazin-1-ium-1-ylidene]-5,11-dihydrobenzo[b][1,4]benzodiazepine |
|---|---|
| PubChem CID | 11038068 |
| Molecular Formula | C24H23Cl2N4+ |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-chloro-6-[4-[(2-chlorophenyl)methyl]piperazin-1-ium-1-ylidene]-5,11-dihydrobenzo[b][1,4]benzodiazepine |
| SMILES | Clc1ccc2c(c1)NC(=[N+]1CCN(Cc3ccccc3Cl)CC1)c1ccccc1N2 |
| InChI | InChI=1S/C24H22Cl2N4/c25-18-9-10-22-23(15-18)28-24(19-6-2-4-8-21(19)27-22)30-13-11-29(12-14-30)16-17-5-1-3-7-20(17)26/h1-10,15H,11-14,16H2,(H,27,28)/p+1 |
| InChIKey | CGPSWGDMYKADBY-UHFFFAOYSA-O |
| XLogP | 5.44 |
| TPSA | 30.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|