C18H18Cl3N3O — CID 2321281
2,4-dichloro-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]benzamide (PubChem CID 2321281) has the molecular formula C18H18Cl3N3O and a molecular weight of 398.72 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 2321281 |
| Molecular Formula | C18H18Cl3N3O |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2,4-dichloro-N-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]benzamide |
| SMILES | O=C(NN1CCN(Cc2ccccc2Cl)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl3N3O/c19-14-5-6-15(17(21)11-14)18(25)22-24-9-7-23(8-10-24)12-13-3-1-2-4-16(13)20/h1-6,11H,7-10,12H2,(H,22,25) |
| InChIKey | PKWBXWFEGDKGBE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |