C24H24Cl2N4 — CID 11729869
6-(4-benzylpiperazin-1-ium-1-ylidene)-3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepine chloride (PubChem CID 11729869) has the molecular formula C24H24Cl2N4 and a molecular weight of 439.39 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-ium-1-ylidene)-3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepine chloride.
| Compound Name | 6-(4-benzylpiperazin-1-ium-1-ylidene)-3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepine chloride |
|---|---|
| PubChem CID | 11729869 |
| Molecular Formula | C24H24Cl2N4 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 6-(4-benzylpiperazin-1-ium-1-ylidene)-3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepine chloride |
| SMILES | Clc1ccc2c(c1)NC(=[N+]1CCN(Cc3ccccc3)CC1)c1ccccc1N2.[Cl-] |
| InChI | InChI=1S/C24H23ClN4.ClH/c25-19-10-11-22-23(16-19)27-24(20-8-4-5-9-21(20)26-22)29-14-12-28(13-15-29)17-18-6-2-1-3-7-18;/h1-11,16H,12-15,17H2,(H,26,27);1H |
| InChIKey | APRVLIOBZNCMCD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 30.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|