C16H23N4+ — CID 10959073
10-benzyl-4,7,10-triaza-1-azoniatricyclo[5.5.1.04,13]tridec-1(13)-ene (PubChem CID 10959073) has the molecular formula C16H23N4+ and a molecular weight of 271.39 g/mol. Its IUPAC name is 10-benzyl-4,7,10-triaza-1-azoniatricyclo[5.5.1.04,13]tridec-1(13)-ene.
| Compound Name | 10-benzyl-4,7,10-triaza-1-azoniatricyclo[5.5.1.04,13]tridec-1(13)-ene |
|---|---|
| PubChem CID | 10959073 |
| Molecular Formula | C16H23N4+ |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 10-benzyl-4,7,10-triaza-1-azoniatricyclo[5.5.1.04,13]tridec-1(13)-ene |
| SMILES | c1ccc(CN2CCN3CCN4CC[N+](=C34)CC2)cc1 |
| InChI | InChI=1S/C16H23N4/c1-2-4-15(5-3-1)14-17-6-8-18-10-12-20-13-11-19(9-7-17)16(18)20/h1-5H,6-14H2/q+1 |
| InChIKey | IJWMKTQORJIWBV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 12.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|