C14H15Cl2N5 — CID 60726999
2-(4-benzylpiperazin-1-yl)-4,6-dichloro-1,3,5-triazine (PubChem CID 60726999) has the molecular formula C14H15Cl2N5 and a molecular weight of 324.22 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-4,6-dichloro-1,3,5-triazine.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-4,6-dichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 60726999 |
| Molecular Formula | C14H15Cl2N5 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-4,6-dichloro-1,3,5-triazine |
| SMILES | Clc1nc(Cl)nc(N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C14H15Cl2N5/c15-12-17-13(16)19-14(18-12)21-8-6-20(7-9-21)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | OAYNGCULCMRVME-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |