C15H17Cl2N5 — CID 130766041
2-(4-benzyl-2-methylpiperazin-1-yl)-4,6-dichloro-1,3,5-triazine (PubChem CID 130766041) has the molecular formula C15H17Cl2N5 and a molecular weight of 338.24 g/mol. Its IUPAC name is 2-(4-benzyl-2-methylpiperazin-1-yl)-4,6-dichloro-1,3,5-triazine.
| Compound Name | 2-(4-benzyl-2-methylpiperazin-1-yl)-4,6-dichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 130766041 |
| Molecular Formula | C15H17Cl2N5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-(4-benzyl-2-methylpiperazin-1-yl)-4,6-dichloro-1,3,5-triazine |
| SMILES | CC1CN(Cc2ccccc2)CCN1c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C15H17Cl2N5/c1-11-9-21(10-12-5-3-2-4-6-12)7-8-22(11)15-19-13(16)18-14(17)20-15/h2-6,11H,7-10H2,1H3 |
| InChIKey | LJVURACGBBXZOJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |