C13H13Cl2N5 — CID 62859583
2,4-dichloro-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine (PubChem CID 62859583) has the molecular formula C13H13Cl2N5 and a molecular weight of 310.19 g/mol. Its IUPAC name is 2,4-dichloro-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 62859583 |
| Molecular Formula | C13H13Cl2N5 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2,4-dichloro-6-(4-phenylpiperazin-1-yl)-1,3,5-triazine |
| SMILES | Clc1nc(Cl)nc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C13H13Cl2N5/c14-11-16-12(15)18-13(17-11)20-8-6-19(7-9-20)10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | SKTMNDDADNKIOK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |