C23H23Cl2N5 — CID 10983036
3-chloro-6-[4-(pyridin-2-ylmethyl)piperazin-1-ium-1-ylidene]-5,11-dihydrobenzo[b][1,4]benzodiazepine chloride (PubChem CID 10983036) has the molecular formula C23H23Cl2N5 and a molecular weight of 440.38 g/mol. Its IUPAC name is 3-chloro-6-[4-(pyridin-2-ylmethyl)piperazin-1-ium-1-ylidene]-5,11-dihydrobenzo[b][1,4]benzodiazepine chloride.
| Compound Name | 3-chloro-6-[4-(pyridin-2-ylmethyl)piperazin-1-ium-1-ylidene]-5,11-dihydrobenzo[b][1,4]benzodiazepine chloride |
|---|---|
| PubChem CID | 10983036 |
| Molecular Formula | C23H23Cl2N5 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-chloro-6-[4-(pyridin-2-ylmethyl)piperazin-1-ium-1-ylidene]-5,11-dihydrobenzo[b][1,4]benzodiazepine chloride |
| SMILES | Clc1ccc2c(c1)NC(=[N+]1CCN(Cc3ccccn3)CC1)c1ccccc1N2.[Cl-] |
| InChI | InChI=1S/C23H22ClN5.ClH/c24-17-8-9-21-22(15-17)27-23(19-6-1-2-7-20(19)26-21)29-13-11-28(12-14-29)16-18-5-3-4-10-25-18;/h1-10,15H,11-14,16H2,(H,26,27);1H |
| InChIKey | VMFREZOHFOXJGO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|