C17H19ClFN3 — CID 45366948
1-[(2-chloro-4-fluorophenyl)methyl]-4-(pyridin-2-ylmethyl)piperazine (PubChem CID 45366948) has the molecular formula C17H19ClFN3 and a molecular weight of 319.81 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-4-(pyridin-2-ylmethyl)piperazine.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-4-(pyridin-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 45366948 |
| Molecular Formula | C17H19ClFN3 |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-4-(pyridin-2-ylmethyl)piperazine |
| SMILES | Fc1ccc(CN2CCN(Cc3ccccn3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H19ClFN3/c18-17-11-15(19)5-4-14(17)12-21-7-9-22(10-8-21)13-16-3-1-2-6-20-16/h1-6,11H,7-10,12-13H2 |
| InChIKey | MMBYPTCZQAIWCO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |