C19H18ClN5 — CID 135139114
7-chloro-2-N-[2-(methylamino)phenyl]-5,10-dihydrophenazine-2,3-diamine (PubChem CID 135139114) has the molecular formula C19H18ClN5 and a molecular weight of 351.84 g/mol. Its IUPAC name is 7-chloro-2-N-[2-(methylamino)phenyl]-5,10-dihydrophenazine-2,3-diamine.
| Compound Name | 7-chloro-2-N-[2-(methylamino)phenyl]-5,10-dihydrophenazine-2,3-diamine |
|---|---|
| PubChem CID | 135139114 |
| Molecular Formula | C19H18ClN5 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 7-chloro-2-N-[2-(methylamino)phenyl]-5,10-dihydrophenazine-2,3-diamine |
| SMILES | CNc1ccccc1Nc1cc2c(cc1N)Nc1cc(Cl)ccc1N2 |
| InChI | InChI=1S/C19H18ClN5/c1-22-13-4-2-3-5-14(13)23-16-10-19-18(9-12(16)21)25-17-8-11(20)6-7-15(17)24-19/h2-10,22-25H,21H2,1H3 |
| InChIKey | PDZRRWJKTIJOPB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|