C17H15ClN2 — CID 86577123
6-chloro-1-N-(2-methylphenyl)naphthalene-1,4-diamine (PubChem CID 86577123) has the molecular formula C17H15ClN2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 6-chloro-1-N-(2-methylphenyl)naphthalene-1,4-diamine.
| Compound Name | 6-chloro-1-N-(2-methylphenyl)naphthalene-1,4-diamine |
|---|---|
| PubChem CID | 86577123 |
| Molecular Formula | C17H15ClN2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-chloro-1-N-(2-methylphenyl)naphthalene-1,4-diamine |
| SMILES | Cc1ccccc1Nc1ccc(N)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H15ClN2/c1-11-4-2-3-5-16(11)20-17-9-8-15(19)14-10-12(18)6-7-13(14)17/h2-10,20H,19H2,1H3 |
| InChIKey | XGRBTWPSWIZWHU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|