C15H13ClFN3O — CID 43455637
6-amino-7-(5-chloro-2-fluoroanilino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43455637) has the molecular formula C15H13ClFN3O and a molecular weight of 305.74 g/mol. Its IUPAC name is 6-amino-7-(5-chloro-2-fluoroanilino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-(5-chloro-2-fluoroanilino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43455637 |
| Molecular Formula | C15H13ClFN3O |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 6-amino-7-(5-chloro-2-fluoroanilino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1cc2c(cc1Nc1cc(Cl)ccc1F)NC(=O)CC2 |
| InChI | InChI=1S/C15H13ClFN3O/c16-9-2-3-10(17)13(6-9)19-14-7-12-8(5-11(14)18)1-4-15(21)20-12/h2-3,5-7,19H,1,4,18H2,(H,20,21) |
| InChIKey | XVEODCZMJPAPIA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|