C18H17N5O — CID 155329471
8-amino-7-(4-aminoanilino)-5,10-dihydrophenazin-2-ol (PubChem CID 155329471) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 8-amino-7-(4-aminoanilino)-5,10-dihydrophenazin-2-ol.
| Compound Name | 8-amino-7-(4-aminoanilino)-5,10-dihydrophenazin-2-ol |
|---|---|
| PubChem CID | 155329471 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 8-amino-7-(4-aminoanilino)-5,10-dihydrophenazin-2-ol |
| SMILES | Nc1ccc(Nc2cc3c(cc2N)Nc2cc(O)ccc2N3)cc1 |
| InChI | InChI=1S/C18H17N5O/c19-10-1-3-11(4-2-10)21-15-9-18-17(8-13(15)20)23-16-7-12(24)5-6-14(16)22-18/h1-9,21-24H,19-20H2 |
| InChIKey | ANVPBHXBBWDSNO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|