C13H12N4O — CID 118867545
2-(2,5-diaminoanilino)-4-hydroxybenzonitrile (PubChem CID 118867545) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-(2,5-diaminoanilino)-4-hydroxybenzonitrile.
| Compound Name | 2-(2,5-diaminoanilino)-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 118867545 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(2,5-diaminoanilino)-4-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)cc1Nc1cc(N)ccc1N |
| InChI | InChI=1S/C13H12N4O/c14-7-8-1-3-10(18)6-12(8)17-13-5-9(15)2-4-11(13)16/h1-6,17-18H,15-16H2 |
| InChIKey | YLEYTTHPANHUHX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|