C13H8BrCl2N3 — CID 107797069
2-(2-amino-4,5-dichloroanilino)-4-bromobenzonitrile (PubChem CID 107797069) has the molecular formula C13H8BrCl2N3 and a molecular weight of 357.04 g/mol. Its IUPAC name is 2-(2-amino-4,5-dichloroanilino)-4-bromobenzonitrile.
| Compound Name | 2-(2-amino-4,5-dichloroanilino)-4-bromobenzonitrile |
|---|---|
| PubChem CID | 107797069 |
| Molecular Formula | C13H8BrCl2N3 |
| Molecular Weight | 357.04 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 2-(2-amino-4,5-dichloroanilino)-4-bromobenzonitrile |
| SMILES | N#Cc1ccc(Br)cc1Nc1cc(Cl)c(Cl)cc1N |
| InChI | InChI=1S/C13H8BrCl2N3/c14-8-2-1-7(6-17)12(3-8)19-13-5-10(16)9(15)4-11(13)18/h1-5,19H,18H2 |
| InChIKey | ZLNJVSYDJFBFGZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.04 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|