C13H16N4O — CID 118867539
4-amino-2-(2,5-diamino-4-methylanilino)phenol (PubChem CID 118867539) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-amino-2-(2,5-diamino-4-methylanilino)phenol.
| Compound Name | 4-amino-2-(2,5-diamino-4-methylanilino)phenol |
|---|---|
| PubChem CID | 118867539 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-amino-2-(2,5-diamino-4-methylanilino)phenol |
| SMILES | Cc1cc(N)c(Nc2cc(N)ccc2O)cc1N |
| InChI | InChI=1S/C13H16N4O/c1-7-4-10(16)11(6-9(7)15)17-12-5-8(14)2-3-13(12)18/h2-6,17-18H,14-16H2,1H3 |
| InChIKey | NEVCEFMYIRFEIB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|