About 2,2-diethyl-1,3-dihydroquinazolin-4-one
2,2-diethyl-1,3-dihydroquinazolin-4-one (PubChem CID 12925301) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,2-diethyl-1,3-dihydroquinazolin-4-one.
Molecular Properties
| Compound Name | 2,2-diethyl-1,3-dihydroquinazolin-4-one |
| PubChem CID | 12925301 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2,2-diethyl-1,3-dihydroquinazolin-4-one |
| SMILES | CCC1(CC)NC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C12H16N2O/c1-3-12(4-2)13-10-8-6-5-7-9(10)11(15)14-12/h5-8,13H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | MPPQVKBWWYRGDM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-diethyl-1,3-dihydroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-1,3-dihydroquinazolin-4-one?
The IUPAC name of 2,2-diethyl-1,3-dihydroquinazolin-4-one (CID 12925301) is 2,2-diethyl-1,3-dihydroquinazolin-4-one.
What is the SMILES notation for 2,2-diethyl-1,3-dihydroquinazolin-4-one?
The canonical SMILES for 2,2-diethyl-1,3-dihydroquinazolin-4-one is CCC1(CC)NC(=O)c2ccccc2N1.
What is the InChIKey of 2,2-diethyl-1,3-dihydroquinazolin-4-one?
The InChIKey is MPPQVKBWWYRGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-3-12(4-2)13-10-8-6-5-7-9(10)11(15)14-12/h5-8,13H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 2,2-diethyl-1,3-dihydroquinazolin-4-one?
2,2-diethyl-1,3-dihydroquinazolin-4-one has a molecular weight of 204.27 g/mol, XLogP of 2.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-1,3-dihydroquinazolin-4-one is sourced from PubChem (CID 12925301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).