C10H9F2N — CID 139301743
2,3-difluoro-2-methyl-1H-quinoline (PubChem CID 139301743) has the molecular formula C10H9F2N and a molecular weight of 181.19 g/mol. Its IUPAC name is 2,3-difluoro-2-methyl-1H-quinoline.
| Compound Name | 2,3-difluoro-2-methyl-1H-quinoline |
|---|---|
| PubChem CID | 139301743 |
| Molecular Formula | C10H9F2N |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2,3-difluoro-2-methyl-1H-quinoline |
| SMILES | CC1(F)Nc2ccccc2C=C1F |
| InChI | InChI=1S/C10H9F2N/c1-10(12)9(11)6-7-4-2-3-5-8(7)13-10/h2-6,13H,1H3 |
| InChIKey | YSAPDGNHKJDBBO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|