C13H15N — CID 102386267
3a-methyl-1,2,3,4-tetrahydrocyclopenta[b]quinoline (PubChem CID 102386267) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 3a-methyl-1,2,3,4-tetrahydrocyclopenta[b]quinoline.
| Compound Name | 3a-methyl-1,2,3,4-tetrahydrocyclopenta[b]quinoline |
|---|---|
| PubChem CID | 102386267 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3a-methyl-1,2,3,4-tetrahydrocyclopenta[b]quinoline |
| SMILES | CC12CCCC1=Cc1ccccc1N2 |
| InChI | InChI=1S/C13H15N/c1-13-8-4-6-11(13)9-10-5-2-3-7-12(10)14-13/h2-3,5,7,9,14H,4,6,8H2,1H3 |
| InChIKey | GTQZDUYFBXHVSO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |