C20H22N2 — CID 11781265
(1R,2R,10S,11S)-10,11-dimethyl-9,12-diazapentacyclo[9.7.1.12,10.03,8.013,18]icosa-3,5,7,13,15,17-hexaene (PubChem CID 11781265) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (1R,2R,10S,11S)-10,11-dimethyl-9,12-diazapentacyclo[9.7.1.12,10.03,8.013,18]icosa-3,5,7,13,15,17-hexaene.
| Compound Name | (1R,2R,10S,11S)-10,11-dimethyl-9,12-diazapentacyclo[9.7.1.12,10.03,8.013,18]icosa-3,5,7,13,15,17-hexaene |
|---|---|
| PubChem CID | 11781265 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (1R,2R,10S,11S)-10,11-dimethyl-9,12-diazapentacyclo[9.7.1.12,10.03,8.013,18]icosa-3,5,7,13,15,17-hexaene |
| SMILES | C[C@@]12C[C@@H](c3ccccc3N1)[C@H]1C[C@]2(C)Nc2ccccc21 |
| InChI | InChI=1S/C20H22N2/c1-19-11-15(13-7-3-5-9-17(13)21-19)16-12-20(19,2)22-18-10-6-4-8-14(16)18/h3-10,15-16,21-22H,11-12H2,1-2H3/t15-,16-,19-,20-/m0/s1 |
| InChIKey | BUBFKGPFTSSQPA-FVCZOJIISA-N |
| XLogP | 4.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |