C18H18N2O3 — CID 98100589
(1R,9S,11R,12S)-9-methyl-12-nitro-11-phenyl-13-oxa-8-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 98100589) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is (1R,9S,11R,12S)-9-methyl-12-nitro-11-phenyl-13-oxa-8-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
| Compound Name | (1R,9S,11R,12S)-9-methyl-12-nitro-11-phenyl-13-oxa-8-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 98100589 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (1R,9S,11R,12S)-9-methyl-12-nitro-11-phenyl-13-oxa-8-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
| SMILES | C[C@@]12C[C@H](c3ccccc3)[C@H]([N+](=O)[O-])[C@H](O1)c1ccccc1N2 |
| InChI | InChI=1S/C18H18N2O3/c1-18-11-14(12-7-3-2-4-8-12)16(20(21)22)17(23-18)13-9-5-6-10-15(13)19-18/h2-10,14,16-17,19H,11H2,1H3/t14-,16+,17-,18+/m1/s1 |
| InChIKey | YIKIVCPEROTXPQ-SPUZQDLCSA-N |
| XLogP | 3.72 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|