C14H18N2O2 — CID 92856471
(1S,5S,6S)-N,N-dimethyl-6-nitro-5-phenylcyclohex-2-en-1-amine (PubChem CID 92856471) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1S,5S,6S)-N,N-dimethyl-6-nitro-5-phenylcyclohex-2-en-1-amine.
| Compound Name | (1S,5S,6S)-N,N-dimethyl-6-nitro-5-phenylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 92856471 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (1S,5S,6S)-N,N-dimethyl-6-nitro-5-phenylcyclohex-2-en-1-amine |
| SMILES | CN(C)[C@H]1C=CC[C@@H](c2ccccc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O2/c1-15(2)13-10-6-9-12(14(13)16(17)18)11-7-4-3-5-8-11/h3-8,10,12-14H,9H2,1-2H3/t12-,13-,14-/m0/s1 |
| InChIKey | XEFALROTPLJINF-IHRRRGAJSA-N |
| XLogP | 2.31 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|