C11H17N3 — CID 78235357
N,N-dimethyl-4-phenylpyrazolidin-3-amine (PubChem CID 78235357) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N,N-dimethyl-4-phenylpyrazolidin-3-amine.
| Compound Name | N,N-dimethyl-4-phenylpyrazolidin-3-amine |
|---|---|
| PubChem CID | 78235357 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N,N-dimethyl-4-phenylpyrazolidin-3-amine |
| SMILES | CN(C)C1NNCC1c1ccccc1 |
| InChI | InChI=1S/C11H17N3/c1-14(2)11-10(8-12-13-11)9-6-4-3-5-7-9/h3-7,10-13H,8H2,1-2H3 |
| InChIKey | UKYMKNJQZKUALY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |