C13H15NO3 — CID 14595129
(2R,4S,5R)-2-methyl-4-nitro-5-phenylcyclohexan-1-one (PubChem CID 14595129) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (2R,4S,5R)-2-methyl-4-nitro-5-phenylcyclohexan-1-one.
| Compound Name | (2R,4S,5R)-2-methyl-4-nitro-5-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 14595129 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2R,4S,5R)-2-methyl-4-nitro-5-phenylcyclohexan-1-one |
| SMILES | C[C@@H]1C[C@H]([N+](=O)[O-])[C@@H](c2ccccc2)CC1=O |
| InChI | InChI=1S/C13H15NO3/c1-9-7-12(14(16)17)11(8-13(9)15)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3/t9-,11-,12+/m1/s1 |
| InChIKey | TVJHNOPGUORZGI-JLLWLGSASA-N |
| XLogP | 2.41 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|