C22H24O2 — CID 102003889
(2R,3S,4S,5S)-2-methyl-3,5-diphenyl-4-propanoylcyclohexan-1-one (PubChem CID 102003889) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-methyl-3,5-diphenyl-4-propanoylcyclohexan-1-one.
| Compound Name | (2R,3S,4S,5S)-2-methyl-3,5-diphenyl-4-propanoylcyclohexan-1-one |
|---|---|
| PubChem CID | 102003889 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2R,3S,4S,5S)-2-methyl-3,5-diphenyl-4-propanoylcyclohexan-1-one |
| SMILES | CCC(=O)[C@@H]1[C@@H](c2ccccc2)[C@@H](C)C(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24O2/c1-3-19(23)22-18(16-10-6-4-7-11-16)14-20(24)15(2)21(22)17-12-8-5-9-13-17/h4-13,15,18,21-22H,3,14H2,1-2H3/t15-,18+,21+,22+/m0/s1 |
| InChIKey | BLBMUBMXUQBREC-UKYAFMKFSA-N |
| XLogP | 4.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |