C15H14O5-2 — CID 6946149
(1R,2S,3R,4S)-4-methyl-5-oxo-3-phenylcyclohexane-1,2-dicarboxylate (PubChem CID 6946149) has the molecular formula C15H14O5-2 and a molecular weight of 274.27 g/mol. Its IUPAC name is (1R,2S,3R,4S)-4-methyl-5-oxo-3-phenylcyclohexane-1,2-dicarboxylate.
| Compound Name | (1R,2S,3R,4S)-4-methyl-5-oxo-3-phenylcyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6946149 |
| Molecular Formula | C15H14O5-2 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (1R,2S,3R,4S)-4-methyl-5-oxo-3-phenylcyclohexane-1,2-dicarboxylate |
| SMILES | C[C@@H]1C(=O)C[C@@H](C(=O)[O-])[C@@H](C(=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H16O5/c1-8-11(16)7-10(14(17)18)13(15(19)20)12(8)9-5-3-2-4-6-9/h2-6,8,10,12-13H,7H2,1H3,(H,17,18)(H,19,20)/p-2/t8-,10-,12+,13-/m1/s1 |
| InChIKey | OMBRLPPLFPUYRP-HMHPOGMRSA-L |
| XLogP | -0.89 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |