C10H12O4-2 — CID 11871326
(1S,2R,3R)-3,5-dimethylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 11871326) has the molecular formula C10H12O4-2 and a molecular weight of 196.20 g/mol. Its IUPAC name is (1S,2R,3R)-3,5-dimethylcyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | (1S,2R,3R)-3,5-dimethylcyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11871326 |
| Molecular Formula | C10H12O4-2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (1S,2R,3R)-3,5-dimethylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CC1=C[C@@H](C)[C@@H](C(=O)[O-])[C@@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C10H14O4/c1-5-3-6(2)8(10(13)14)7(4-5)9(11)12/h3,6-8H,4H2,1-2H3,(H,11,12)(H,13,14)/p-2/t6-,7+,8-/m1/s1 |
| InChIKey | ZSVDBGWHEBFPNB-GJMOJQLCSA-L |
| XLogP | -1.30 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|