C14H22 — CID 58674044
1,3-dimethyl-4,5-bis(prop-1-en-2-yl)cyclohexene (PubChem CID 58674044) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1,3-dimethyl-4,5-bis(prop-1-en-2-yl)cyclohexene.
| Compound Name | 1,3-dimethyl-4,5-bis(prop-1-en-2-yl)cyclohexene |
|---|---|
| PubChem CID | 58674044 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1,3-dimethyl-4,5-bis(prop-1-en-2-yl)cyclohexene |
| SMILES | C=C(C)C1CC(C)=CC(C)C1C(=C)C |
| InChI | InChI=1S/C14H22/c1-9(2)13-8-11(5)7-12(6)14(13)10(3)4/h7,12-14H,1,3,8H2,2,4-6H3 |
| InChIKey | LMRURSHMRIVREV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|