C11H17NO5S — CID 163439772
[(6-acetyl-3,5-dimethylcyclohex-3-ene-1-carbonyl)amino] hydrogen sulfite (PubChem CID 163439772) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is [(6-acetyl-3,5-dimethylcyclohex-3-ene-1-carbonyl)amino] hydrogen sulfite.
| Compound Name | [(6-acetyl-3,5-dimethylcyclohex-3-ene-1-carbonyl)amino] hydrogen sulfite |
|---|---|
| PubChem CID | 163439772 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [(6-acetyl-3,5-dimethylcyclohex-3-ene-1-carbonyl)amino] hydrogen sulfite |
| SMILES | CC(=O)C1C(C)C=C(C)CC1C(=O)NOS(=O)O |
| InChI | InChI=1S/C11H17NO5S/c1-6-4-7(2)10(8(3)13)9(5-6)11(14)12-17-18(15)16/h4,7,9-10H,5H2,1-3H3,(H,12,14)(H,15,16) |
| InChIKey | YEAIMAMIPRYMSP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|