C14H23NO4 — CID 11907506
(1R,5R,6R)-6-[2-(dimethylazaniumyl)ethoxycarbonyl]-3,5-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 11907506) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is (1R,5R,6R)-6-[2-(dimethylazaniumyl)ethoxycarbonyl]-3,5-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,5R,6R)-6-[2-(dimethylazaniumyl)ethoxycarbonyl]-3,5-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11907506 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (1R,5R,6R)-6-[2-(dimethylazaniumyl)ethoxycarbonyl]-3,5-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C[C@@H](C)[C@@H](C(=O)OCC[NH+](C)C)[C@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C14H23NO4/c1-9-7-10(2)12(11(8-9)13(16)17)14(18)19-6-5-15(3)4/h7,10-12H,5-6,8H2,1-4H3,(H,16,17)/t10-,11-,12-/m1/s1 |
| InChIKey | UWKFNPDBBIBDBH-IJLUTSLNSA-N |
| XLogP | -1.36 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|