C18H24O2 — CID 175118402
2-phenylethyl 2,4,6-trimethylcyclohex-3-ene-1-carboxylate (PubChem CID 175118402) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-phenylethyl 2,4,6-trimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | 2-phenylethyl 2,4,6-trimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 175118402 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-phenylethyl 2,4,6-trimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CC1=CC(C)C(C(=O)OCCc2ccccc2)C(C)C1 |
| InChI | InChI=1S/C18H24O2/c1-13-11-14(2)17(15(3)12-13)18(19)20-10-9-16-7-5-4-6-8-16/h4-8,11,14-15,17H,9-10,12H2,1-3H3 |
| InChIKey | TZKLLWISEHNRDT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|