C16H19N2O3- — CID 7058231
(1S,2R,6S)-2,4-dimethyl-6-(pyridin-3-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylate (PubChem CID 7058231) has the molecular formula C16H19N2O3- and a molecular weight of 287.34 g/mol. Its IUPAC name is (1S,2R,6S)-2,4-dimethyl-6-(pyridin-3-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,2R,6S)-2,4-dimethyl-6-(pyridin-3-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7058231 |
| Molecular Formula | C16H19N2O3- |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (1S,2R,6S)-2,4-dimethyl-6-(pyridin-3-ylmethylcarbamoyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CC1=C[C@@H](C)[C@H](C(=O)[O-])[C@@H](C(=O)NCc2cccnc2)C1 |
| InChI | InChI=1S/C16H20N2O3/c1-10-6-11(2)14(16(20)21)13(7-10)15(19)18-9-12-4-3-5-17-8-12/h3-6,8,11,13-14H,7,9H2,1-2H3,(H,18,19)(H,20,21)/p-1/t11-,13+,14+/m1/s1 |
| InChIKey | BWUMIDKCCNRFQN-XBFCOCLRSA-M |
| XLogP | 0.67 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|