C15H18N2O3 — CID 782180
(1R,2S,6R)-2,4-dimethyl-6-(pyridin-3-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 782180) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (1R,2S,6R)-2,4-dimethyl-6-(pyridin-3-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,2S,6R)-2,4-dimethyl-6-(pyridin-3-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 782180 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (1R,2S,6R)-2,4-dimethyl-6-(pyridin-3-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C[C@H](C)[C@@H](C(=O)O)[C@H](C(=O)Nc2cccnc2)C1 |
| InChI | InChI=1S/C15H18N2O3/c1-9-6-10(2)13(15(19)20)12(7-9)14(18)17-11-4-3-5-16-8-11/h3-6,8,10,12-13H,7H2,1-2H3,(H,17,18)(H,19,20)/t10-,12+,13+/m0/s1 |
| InChIKey | BPTDYORIUWSERV-CYZMBNFOSA-N |
| XLogP | 2.32 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|