C25H28O — CID 22331029
[4,5-dimethyl-2-(2-methylprop-1-enyl)-6-phenylcyclohex-3-en-1-yl]-phenylmethanone (PubChem CID 22331029) has the molecular formula C25H28O and a molecular weight of 344.50 g/mol. Its IUPAC name is [4,5-dimethyl-2-(2-methylprop-1-enyl)-6-phenylcyclohex-3-en-1-yl]-phenylmethanone.
| Compound Name | [4,5-dimethyl-2-(2-methylprop-1-enyl)-6-phenylcyclohex-3-en-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 22331029 |
| Molecular Formula | C25H28O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | [4,5-dimethyl-2-(2-methylprop-1-enyl)-6-phenylcyclohex-3-en-1-yl]-phenylmethanone |
| SMILES | CC(C)=CC1C=C(C)C(C)C(c2ccccc2)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28O/c1-17(2)15-22-16-18(3)19(4)23(20-11-7-5-8-12-20)24(22)25(26)21-13-9-6-10-14-21/h5-16,19,22-24H,1-4H3 |
| InChIKey | GJENINOYNNXUER-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|