C25H21O4- — CID 7375093
trans-(2R,4R)-3-(2-methylphenoxy)carbonyl-2,4-diphenylcyclobutane-1-carboxylate (PubChem CID 7375093) has the molecular formula C25H21O4- and a molecular weight of 385.44 g/mol. Its IUPAC name is trans-(2R,4R)-3-(2-methylphenoxy)carbonyl-2,4-diphenylcyclobutane-1-carboxylate.
| Compound Name | trans-(2R,4R)-3-(2-methylphenoxy)carbonyl-2,4-diphenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 7375093 |
| Molecular Formula | C25H21O4- |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | trans-(2R,4R)-3-(2-methylphenoxy)carbonyl-2,4-diphenylcyclobutane-1-carboxylate |
| SMILES | Cc1ccccc1OC(=O)C1[C@H](c2ccccc2)C(C(=O)[O-])[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H22O4/c1-16-10-8-9-15-19(16)29-25(28)23-20(17-11-4-2-5-12-17)22(24(26)27)21(23)18-13-6-3-7-14-18/h2-15,20-23H,1H3,(H,26,27)/p-1/t20-,21-,22?,23?/m1/s1 |
| InChIKey | WUQLIJJPZVMJTA-KBFCKHRLSA-M |
| XLogP | 3.46 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|