C28H21NaO4 — CID 156597128
sodium 3-naphthalen-1-yloxycarbonyl-2,4-diphenylcyclobutane-1-carboxylate (PubChem CID 156597128) has the molecular formula C28H21NaO4 and a molecular weight of 444.46 g/mol. Its IUPAC name is sodium 3-naphthalen-1-yloxycarbonyl-2,4-diphenylcyclobutane-1-carboxylate.
| Compound Name | sodium 3-naphthalen-1-yloxycarbonyl-2,4-diphenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 156597128 |
| Molecular Formula | C28H21NaO4 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | sodium 3-naphthalen-1-yloxycarbonyl-2,4-diphenylcyclobutane-1-carboxylate |
| SMILES | O=C([O-])C1C(c2ccccc2)C(C(=O)Oc2cccc3ccccc23)C1c1ccccc1.[Na+] |
| InChI | InChI=1S/C28H22O4.Na/c29-27(30)25-23(19-11-3-1-4-12-19)26(24(25)20-13-5-2-6-14-20)28(31)32-22-17-9-15-18-10-7-8-16-21(18)22;/h1-17,23-26H,(H,29,30);/q;+1/p-1 |
| InChIKey | FNDYRXBMOVWBAD-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|