C56H44O8 — CID 158508632
(2R)-3-naphthalen-1-yloxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid (PubChem CID 158508632) has the molecular formula C56H44O8 and a molecular weight of 844.96 g/mol. Its IUPAC name is (2R)-3-naphthalen-1-yloxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid.
| Compound Name | (2R)-3-naphthalen-1-yloxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 158508632 |
| Molecular Formula | C56H44O8 |
| Molecular Weight | 844.96 g/mol |
| Exact Mass | 844.30 |
| IUPAC Name | (2R)-3-naphthalen-1-yloxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1C(c2ccccc2)C(C(=O)Oc2cccc3ccccc23)[C@@H]1c1ccccc1.O=C(O)C1C(c2ccccc2)C(C(=O)Oc2cccc3ccccc23)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/2C28H22O4/c2*29-27(30)25-23(19-11-3-1-4-12-19)26(24(25)20-13-5-2-6-14-20)28(31)32-22-17-9-15-18-10-7-8-16-21(18)22/h2*1-17,23-26H,(H,29,30)/t2*23-,24?,25?,26?/m11/s1 |
| InChIKey | HKTRZYOTSLMICX-QQLLCAPNSA-N |
| XLogP | 11.29 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.96 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|