C31H23NO4 — CID 170520694
trans-(2S,4S)-3-[2-(4-isocyanophenyl)phenoxy]carbonyl-2,4-diphenylcyclobutane-1-carboxylic acid (PubChem CID 170520694) has the molecular formula C31H23NO4 and a molecular weight of 473.53 g/mol. Its IUPAC name is trans-(2S,4S)-3-[2-(4-isocyanophenyl)phenoxy]carbonyl-2,4-diphenylcyclobutane-1-carboxylic acid.
| Compound Name | trans-(2S,4S)-3-[2-(4-isocyanophenyl)phenoxy]carbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 170520694 |
| Molecular Formula | C31H23NO4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | trans-(2S,4S)-3-[2-(4-isocyanophenyl)phenoxy]carbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
| SMILES | [C-]#[N+]c1ccc(-c2ccccc2OC(=O)C2[C@@H](c3ccccc3)C(C(=O)O)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H23NO4/c1-32-23-18-16-20(17-19-23)24-14-8-9-15-25(24)36-31(35)29-26(21-10-4-2-5-11-21)28(30(33)34)27(29)22-12-6-3-7-13-22/h2-19,26-29H,(H,33,34)/t26-,27-,28?,29?/m0/s1 |
| InChIKey | CAZURQCUDDTHCG-QEYWNGHMSA-N |
| XLogP | 6.71 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|