C29H24O4 — CID 163602420
(1R,2R,3R,4R)-2-benzyl-3-naphthalen-2-yloxycarbonyl-4-phenylcyclobutane-1-carboxylic acid (PubChem CID 163602420) has the molecular formula C29H24O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is (1R,2R,3R,4R)-2-benzyl-3-naphthalen-2-yloxycarbonyl-4-phenylcyclobutane-1-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-2-benzyl-3-naphthalen-2-yloxycarbonyl-4-phenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 163602420 |
| Molecular Formula | C29H24O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (1R,2R,3R,4R)-2-benzyl-3-naphthalen-2-yloxycarbonyl-4-phenylcyclobutane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](Cc2ccccc2)[C@@H](C(=O)Oc2ccc3ccccc3c2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H24O4/c30-28(31)26-24(17-19-9-3-1-4-10-19)27(25(26)21-12-5-2-6-13-21)29(32)33-23-16-15-20-11-7-8-14-22(20)18-23/h1-16,18,24-27H,17H2,(H,30,31)/t24-,25-,26-,27-/m1/s1 |
| InChIKey | GYUBPTDVIWLULT-FPCALVHFSA-N |
| XLogP | 5.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|