C33H34O3 — CID 54222053
naphthalen-2-yl (2S,3R)-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate (PubChem CID 54222053) has the molecular formula C33H34O3 and a molecular weight of 478.63 g/mol. Its IUPAC name is naphthalen-2-yl (2S,3R)-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate.
| Compound Name | naphthalen-2-yl (2S,3R)-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 54222053 |
| Molecular Formula | C33H34O3 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | naphthalen-2-yl (2S,3R)-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate |
| SMILES | O=C(Oc1ccc2ccccc2c1)[C@H]1O[C@@H]1c1ccccc1CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C33H34O3/c34-33(35-29-23-22-26-17-10-11-20-28(26)24-29)32-31(36-32)30-21-13-12-19-27(30)18-9-4-2-1-3-6-14-25-15-7-5-8-16-25/h5,7-8,10-13,15-17,19-24,31-32H,1-4,6,9,14,18H2/t31-,32+/m1/s1 |
| InChIKey | QDHBJSHCQYEIOJ-ZWXJPIIXSA-N |
| XLogP | 8.01 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|