C29H31BrO3 — CID 54233659
(4-bromophenyl) (2R,3S)-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate (PubChem CID 54233659) has the molecular formula C29H31BrO3 and a molecular weight of 507.47 g/mol. Its IUPAC name is (4-bromophenyl) (2R,3S)-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate.
| Compound Name | (4-bromophenyl) (2R,3S)-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 54233659 |
| Molecular Formula | C29H31BrO3 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (4-bromophenyl) (2R,3S)-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1)[C@@H]1O[C@H]1c1ccccc1CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C29H31BrO3/c30-24-18-20-25(21-19-24)32-29(31)28-27(33-28)26-17-11-10-16-23(26)15-9-4-2-1-3-6-12-22-13-7-5-8-14-22/h5,7-8,10-11,13-14,16-21,27-28H,1-4,6,9,12,15H2/t27-,28+/m0/s1 |
| InChIKey | QLALDJSZUYMEOC-WUFINQPMSA-N |
| XLogP | 7.62 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|