C33H33O3- — CID 22879913
(2R,3S)-2-naphthalen-2-yl-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate (PubChem CID 22879913) has the molecular formula C33H33O3- and a molecular weight of 477.62 g/mol. Its IUPAC name is (2R,3S)-2-naphthalen-2-yl-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate.
| Compound Name | (2R,3S)-2-naphthalen-2-yl-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 22879913 |
| Molecular Formula | C33H33O3- |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | (2R,3S)-2-naphthalen-2-yl-3-[2-(8-phenyloctyl)phenyl]oxirane-2-carboxylate |
| SMILES | O=C([O-])[C@]1(c2ccc3ccccc3c2)O[C@H]1c1ccccc1CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C33H34O3/c34-32(35)33(29-23-22-26-17-10-11-20-28(26)24-29)31(36-33)30-21-13-12-19-27(30)18-9-4-2-1-3-6-14-25-15-7-5-8-16-25/h5,7-8,10-13,15-17,19-24,31H,1-4,6,9,14,18H2,(H,34,35)/p-1/t31-,33+/m0/s1 |
| InChIKey | KAPWQICVWCMOPE-CQTOTRCISA-M |
| XLogP | 6.68 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|